C21H27F2N3 — CID 135280834
(4E,5Z)-7-[5-(difluoromethyl)-4H-pyrazol-3-yl]-4-ethylidene-N-[(E)-hept-4-en-2-yn-4-yl]octa-5,7-dien-3-amine (PubChem CID 135280834) has the molecular formula C21H27F2N3 and a molecular weight of 359.46 g/mol. Its IUPAC name is (4E,5Z)-7-[5-(difluoromethyl)-4H-pyrazol-3-yl]-4-ethylidene-N-[(E)-hept-4-en-2-yn-4-yl]octa-5,7-dien-3-amine.
| Compound Name | (4E,5Z)-7-[5-(difluoromethyl)-4H-pyrazol-3-yl]-4-ethylidene-N-[(E)-hept-4-en-2-yn-4-yl]octa-5,7-dien-3-amine |
|---|---|
| PubChem CID | 135280834 |
| Molecular Formula | C21H27F2N3 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (4E,5Z)-7-[5-(difluoromethyl)-4H-pyrazol-3-yl]-4-ethylidene-N-[(E)-hept-4-en-2-yn-4-yl]octa-5,7-dien-3-amine |
| SMILES | C=C(/C=C\C(=C/C)C(CC)N/C(C#CC)=C/CC)C1=NN=C(C(F)F)C1 |
| InChI | InChI=1S/C21H27F2N3/c1-6-10-17(11-7-2)24-18(9-4)16(8-3)13-12-15(5)19-14-20(21(22)23)26-25-19/h8,10,12-13,18,21,24H,5-6,9,14H2,1-4H3/b13-12-,16-8+,17-10+ |
| InChIKey | GGVMZDLLFJRRQI-FVENVKRISA-N |
| XLogP | 5.20 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|