C20H26N2S — CID 135280845
N-[1-[4-[2-[2-(methylideneamino)phenyl]ethyl]phenyl]pentyl]thiohydroxylamine (PubChem CID 135280845) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is N-[1-[4-[2-[2-(methylideneamino)phenyl]ethyl]phenyl]pentyl]thiohydroxylamine.
| Compound Name | N-[1-[4-[2-[2-(methylideneamino)phenyl]ethyl]phenyl]pentyl]thiohydroxylamine |
|---|---|
| PubChem CID | 135280845 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-[1-[4-[2-[2-(methylideneamino)phenyl]ethyl]phenyl]pentyl]thiohydroxylamine |
| SMILES | C=Nc1ccccc1CCc1ccc(C(CCCC)NS)cc1 |
| InChI | InChI=1S/C20H26N2S/c1-3-4-8-20(22-23)18-14-11-16(12-15-18)10-13-17-7-5-6-9-19(17)21-2/h5-7,9,11-12,14-15,20,22-23H,2-4,8,10,13H2,1H3 |
| InChIKey | WHFUIVQVIUEXCP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|