C12H19NS — CID 135280877
N-[(3Z)-4-(2,2-dimethylpropylsulfanyl)hexa-1,3,5-trien-3-yl]methanimine (PubChem CID 135280877) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is N-[(3Z)-4-(2,2-dimethylpropylsulfanyl)hexa-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(3Z)-4-(2,2-dimethylpropylsulfanyl)hexa-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 135280877 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[(3Z)-4-(2,2-dimethylpropylsulfanyl)hexa-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(N=C)=C(\C=C)SCC(C)(C)C |
| InChI | InChI=1S/C12H19NS/c1-7-10(13-6)11(8-2)14-9-12(3,4)5/h7-8H,1-2,6,9H2,3-5H3/b11-10- |
| InChIKey | YZLBSTANKSWVJV-KHPPLWFESA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|