C18H25N3 — CID 135280912
1-[4-(5-methyl-4H-imidazol-2-yl)cyclohepta-1,3,6-trien-1-yl]-N-prop-2-enylbutan-1-amine (PubChem CID 135280912) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-[4-(5-methyl-4H-imidazol-2-yl)cyclohepta-1,3,6-trien-1-yl]-N-prop-2-enylbutan-1-amine.
| Compound Name | 1-[4-(5-methyl-4H-imidazol-2-yl)cyclohepta-1,3,6-trien-1-yl]-N-prop-2-enylbutan-1-amine |
|---|---|
| PubChem CID | 135280912 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-[4-(5-methyl-4H-imidazol-2-yl)cyclohepta-1,3,6-trien-1-yl]-N-prop-2-enylbutan-1-amine |
| SMILES | C=CCNC(CCC)C1=CC=C(C2=NCC(C)=N2)CC=C1 |
| InChI | InChI=1S/C18H25N3/c1-4-7-17(19-12-5-2)15-8-6-9-16(11-10-15)18-20-13-14(3)21-18/h5-6,8,10-11,17,19H,2,4,7,9,12-13H2,1,3H3 |
| InChIKey | PFCAIIDAIYGIKK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|