About (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper
(2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper (PubChem CID 135281325) has the molecular formula C9H16CuN2O3
and a molecular weight of 263.78 g/mol. Its IUPAC name is (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper.
Molecular Properties
| Compound Name | (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper |
| PubChem CID | 135281325 |
| Molecular Formula | C9H16CuN2O3 |
| Molecular Weight | 263.78 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper |
| SMILES | C=CC(=O)NCCCC[C@H](N)C(=O)O.[Cu] |
| InChI | InChI=1S/C9H16N2O3.Cu/c1-2-8(12)11-6-4-3-5-7(10)9(13)14;/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14);/t7-;/m0./s1 |
| InChIKey | GZGXLXPYKDBMQH-FJXQXJEOSA-N |
| XLogP | -0.13 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.78 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper?
The IUPAC name of (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper (CID 135281325) is (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper.
What is the SMILES notation for (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper?
The canonical SMILES for (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper is C=CC(=O)NCCCC[C@H](N)C(=O)O.[Cu].
What is the InChIKey of (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper?
The InChIKey is GZGXLXPYKDBMQH-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H16N2O3.Cu/c1-2-8(12)11-6-4-3-5-7(10)9(13)14;/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14);/t7-;/m0./s1.
What are the key properties of (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper?
(2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper has a molecular weight of 263.78 g/mol, XLogP of -0.13, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-6-(prop-2-enoylamino)hexanoic acid;copper is sourced from PubChem (CID 135281325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).