About 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine
2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine (PubChem CID 135281382) has the molecular formula C22H27ClN4O2
and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine |
| PubChem CID | 135281382 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine |
| SMILES | COc1cc(OC)c(-c2cn3ccc(N4CCN(C(C)C)CC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C22H27ClN4O2/c1-15(2)25-7-9-26(10-8-25)16-5-6-27-14-19(24-22(27)11-16)17-12-18(23)21(29-4)13-20(17)28-3/h5-6,11-15H,7-10H2,1-4H3 |
| InChIKey | WZGWHYYOHWACPP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The IUPAC name of 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine (CID 135281382) is 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The canonical SMILES for 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine is COc1cc(OC)c(-c2cn3ccc(N4CCN(C(C)C)CC4)cc3n2)cc1Cl.
What is the InChIKey of 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The InChIKey is WZGWHYYOHWACPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClN4O2/c1-15(2)25-7-9-26(10-8-25)16-5-6-27-14-19(24-22(27)11-16)17-12-18(23)21(29-4)13-20(17)28-3/h5-6,11-15H,7-10H2,1-4H3.
What are the key properties of 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine?
2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine has a molecular weight of 414.94 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-propan-2-ylpiperazin-1-yl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 135281382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).