C31H33FN6O3 — CID 135281910
(2R,4R)-2-N-[5-[1-amino-1-(3-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-1-N-(4-aminophenyl)-4-hydroxypyrrolidine-1,2-dicarboxamide (PubChem CID 135281910) has the molecular formula C31H33FN6O3 and a molecular weight of 556.64 g/mol. Its IUPAC name is (2R,4R)-2-N-[5-[1-amino-1-(3-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-1-N-(4-aminophenyl)-4-hydroxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-2-N-[5-[1-amino-1-(3-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-1-N-(4-aminophenyl)-4-hydroxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 135281910 |
| Molecular Formula | C31H33FN6O3 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | (2R,4R)-2-N-[5-[1-amino-1-(3-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-1-N-(4-aminophenyl)-4-hydroxypyrrolidine-1,2-dicarboxamide |
| SMILES | N#Cc1cccc(C(N)(CCC2CC2)c2ccc(F)c(NC(=O)[C@H]3C[C@@H](O)CN3C(=O)Nc3ccc(N)cc3)c2)c1 |
| InChI | InChI=1S/C31H33FN6O3/c32-26-11-6-22(31(35,13-12-19-4-5-19)21-3-1-2-20(14-21)17-33)15-27(26)37-29(40)28-16-25(39)18-38(28)30(41)36-24-9-7-23(34)8-10-24/h1-3,6-11,14-15,19,25,28,39H,4-5,12-13,16,18,34-35H2,(H,36,41)(H,37,40)/t25-,28-,31?/m1/s1 |
| InChIKey | XAOKWPPAZPSJST-JADDJLNISA-N |
| XLogP | 4.28 |
| TPSA | 157.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|