About 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine
5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine (PubChem CID 135282182) has the molecular formula C19H25F2N3O
and a molecular weight of 349.43 g/mol. Its IUPAC name is 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine |
| PubChem CID | 135282182 |
| Molecular Formula | C19H25F2N3O |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine |
| SMILES | Cc1cc(-c2ccnc(C(F)F)c2)ncc1OCC(C)CC(C)CN |
| InChI | InChI=1S/C19H25F2N3O/c1-12(9-22)6-13(2)11-25-18-10-24-16(7-14(18)3)15-4-5-23-17(8-15)19(20)21/h4-5,7-8,10,12-13,19H,6,9,11,22H2,1-3H3 |
| InChIKey | UZDNRCXREHGLIL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine?
The IUPAC name of 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine (CID 135282182) is 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine.
What is the SMILES notation for 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine?
The canonical SMILES for 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine is Cc1cc(-c2ccnc(C(F)F)c2)ncc1OCC(C)CC(C)CN.
What is the InChIKey of 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine?
The InChIKey is UZDNRCXREHGLIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2N3O/c1-12(9-22)6-13(2)11-25-18-10-24-16(7-14(18)3)15-4-5-23-17(8-15)19(20)21/h4-5,7-8,10,12-13,19H,6,9,11,22H2,1-3H3.
What are the key properties of 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine?
5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine has a molecular weight of 349.43 g/mol, XLogP of 4.39, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-[2-(difluoromethyl)-4-pyridinyl]-4-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-1-amine is sourced from PubChem (CID 135282182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).