About [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate
[5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate (PubChem CID 135282231) has the molecular formula C18H23ClN4O3
and a molecular weight of 378.86 g/mol. Its IUPAC name is [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate.
Molecular Properties
| Compound Name | [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate |
| PubChem CID | 135282231 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate |
| SMILES | CC(C)CC(C)(N)COc1ccc(-c2cnnc(OC(N)=O)c2)cc1Cl |
| InChI | InChI=1S/C18H23ClN4O3/c1-11(2)8-18(3,21)10-25-15-5-4-12(6-14(15)19)13-7-16(23-22-9-13)26-17(20)24/h4-7,9,11H,8,10,21H2,1-3H3,(H2,20,24) |
| InChIKey | HXVSXYYVLCRBEC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate?
The IUPAC name of [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate (CID 135282231) is [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate.
What is the SMILES notation for [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate?
The canonical SMILES for [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate is CC(C)CC(C)(N)COc1ccc(-c2cnnc(OC(N)=O)c2)cc1Cl.
What is the InChIKey of [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate?
The InChIKey is HXVSXYYVLCRBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN4O3/c1-11(2)8-18(3,21)10-25-15-5-4-12(6-14(15)19)13-7-16(23-22-9-13)26-17(20)24/h4-7,9,11H,8,10,21H2,1-3H3,(H2,20,24).
What are the key properties of [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate?
[5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate has a molecular weight of 378.86 g/mol, XLogP of 3.40, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]pyridazin-3-yl] carbamate is sourced from PubChem (CID 135282231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).