C28H26Cl2FN5O3 — CID 135282912
3-[[1-(azidomethyl)cyclopropyl]methoxy]-3-(4-chlorophenyl)-2-[(5-chloro-2-pyridinyl)methyl]-4-fluoro-6-(2-hydroxypropan-2-yl)isoindol-1-one (PubChem CID 135282912) has the molecular formula C28H26Cl2FN5O3 and a molecular weight of 570.45 g/mol. Its IUPAC name is 3-[[1-(azidomethyl)cyclopropyl]methoxy]-3-(4-chlorophenyl)-2-[(5-chloro-2-pyridinyl)methyl]-4-fluoro-6-(2-hydroxypropan-2-yl)isoindol-1-one.
| Compound Name | 3-[[1-(azidomethyl)cyclopropyl]methoxy]-3-(4-chlorophenyl)-2-[(5-chloro-2-pyridinyl)methyl]-4-fluoro-6-(2-hydroxypropan-2-yl)isoindol-1-one |
|---|---|
| PubChem CID | 135282912 |
| Molecular Formula | C28H26Cl2FN5O3 |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 3-[[1-(azidomethyl)cyclopropyl]methoxy]-3-(4-chlorophenyl)-2-[(5-chloro-2-pyridinyl)methyl]-4-fluoro-6-(2-hydroxypropan-2-yl)isoindol-1-one |
| SMILES | CC(C)(O)c1cc(F)c2c(c1)C(=O)N(Cc1ccc(Cl)cn1)C2(OCC1(CN=[N+]=[N-])CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2FN5O3/c1-26(2,38)18-11-22-24(23(31)12-18)28(17-3-5-19(29)6-4-17,39-16-27(9-10-27)15-34-35-32)36(25(22)37)14-21-8-7-20(30)13-33-21/h3-8,11-13,38H,9-10,14-16H2,1-2H3 |
| InChIKey | CBTXOFKZKZZLQO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|