C24H28F2N2O — CID 135283616
3-[4-(cyclohexylmethylamino)-3-fluorophenyl]-N-cyclopropyl-5-fluoro-4-methylbenzamide (PubChem CID 135283616) has the molecular formula C24H28F2N2O and a molecular weight of 398.50 g/mol. Its IUPAC name is 3-[4-(cyclohexylmethylamino)-3-fluorophenyl]-N-cyclopropyl-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[4-(cyclohexylmethylamino)-3-fluorophenyl]-N-cyclopropyl-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 135283616 |
| Molecular Formula | C24H28F2N2O |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-[4-(cyclohexylmethylamino)-3-fluorophenyl]-N-cyclopropyl-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc(NCC2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C24H28F2N2O/c1-15-20(11-18(13-21(15)25)24(29)28-19-8-9-19)17-7-10-23(22(26)12-17)27-14-16-5-3-2-4-6-16/h7,10-13,16,19,27H,2-6,8-9,14H2,1H3,(H,28,29) |
| InChIKey | MHQMUTXOYXRCIG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |