C24H21F6N3O3S2 — CID 135283950
(4S)-4-[(2R,4R)-2-(3,4-difluorophenyl)-4-(trifluoromethyl)piperidin-1-yl]-6-fluoro-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135283950) has the molecular formula C24H21F6N3O3S2 and a molecular weight of 577.57 g/mol. Its IUPAC name is (4S)-4-[(2R,4R)-2-(3,4-difluorophenyl)-4-(trifluoromethyl)piperidin-1-yl]-6-fluoro-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4S)-4-[(2R,4R)-2-(3,4-difluorophenyl)-4-(trifluoromethyl)piperidin-1-yl]-6-fluoro-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135283950 |
| Molecular Formula | C24H21F6N3O3S2 |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | (4S)-4-[(2R,4R)-2-(3,4-difluorophenyl)-4-(trifluoromethyl)piperidin-1-yl]-6-fluoro-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1cc2c(cc1F)[C@@H](N1CC[C@@H](C(F)(F)F)C[C@@H]1c1ccc(F)c(F)c1)CCO2 |
| InChI | InChI=1S/C24H21F6N3O3S2/c25-16-2-1-13(9-17(16)26)20-10-14(24(28,29)30)3-6-33(20)19-4-7-36-21-12-22(18(27)11-15(19)21)38(34,35)32-23-31-5-8-37-23/h1-2,5,8-9,11-12,14,19-20H,3-4,6-7,10H2,(H,31,32)/t14-,19+,20-/m1/s1 |
| InChIKey | CTECJQNAEMBIOQ-VOBQZIQPSA-N |
| XLogP | 6.20 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |