C10H8ClF2N3O2S2 — CID 135284088
4-(1-chloroethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 135284088) has the molecular formula C10H8ClF2N3O2S2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 4-(1-chloroethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(1-chloroethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135284088 |
| Molecular Formula | C10H8ClF2N3O2S2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 4-(1-chloroethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CC(Cl)c1cc(F)c(S(=O)(=O)Nc2ncns2)cc1F |
| InChI | InChI=1S/C10H8ClF2N3O2S2/c1-5(11)6-2-8(13)9(3-7(6)12)20(17,18)16-10-14-4-15-19-10/h2-5H,1H3,(H,14,15,16) |
| InChIKey | ZERUHKNZAWTZMG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|