C25H25F3N4O4S2 — CID 135284118
[1-[(2S)-2-phenylpiperidin-1-yl]-6-(1,2,4-thiadiazol-5-ylsulfamoyl)-3,4-dihydro-2H-naphthalen-1-yl] 2,2,2-trifluoroacetate (PubChem CID 135284118) has the molecular formula C25H25F3N4O4S2 and a molecular weight of 566.63 g/mol. Its IUPAC name is [1-[(2S)-2-phenylpiperidin-1-yl]-6-(1,2,4-thiadiazol-5-ylsulfamoyl)-3,4-dihydro-2H-naphthalen-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(2S)-2-phenylpiperidin-1-yl]-6-(1,2,4-thiadiazol-5-ylsulfamoyl)-3,4-dihydro-2H-naphthalen-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135284118 |
| Molecular Formula | C25H25F3N4O4S2 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [1-[(2S)-2-phenylpiperidin-1-yl]-6-(1,2,4-thiadiazol-5-ylsulfamoyl)-3,4-dihydro-2H-naphthalen-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1(N2CCCC[C@H]2c2ccccc2)CCCc2cc(S(=O)(=O)Nc3ncns3)ccc21)C(F)(F)F |
| InChI | InChI=1S/C25H25F3N4O4S2/c26-25(27,28)22(33)36-24(32-14-5-4-10-21(32)17-7-2-1-3-8-17)13-6-9-18-15-19(11-12-20(18)24)38(34,35)31-23-29-16-30-37-23/h1-3,7-8,11-12,15-16,21H,4-6,9-10,13-14H2,(H,29,30,31)/t21-,24?/m0/s1 |
| InChIKey | ZRZZKVRBACXMIF-XEGCMXMBSA-N |
| XLogP | 5.16 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |