C7HF5N4 — CID 135285320
4-(1,1,2,2,2-pentafluoroethyl)imidazole-1,2-dicarbonitrile (PubChem CID 135285320) has the molecular formula C7HF5N4 and a molecular weight of 236.10 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentafluoroethyl)imidazole-1,2-dicarbonitrile.
| Compound Name | 4-(1,1,2,2,2-pentafluoroethyl)imidazole-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135285320 |
| Molecular Formula | C7HF5N4 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 4-(1,1,2,2,2-pentafluoroethyl)imidazole-1,2-dicarbonitrile |
| SMILES | N#Cc1nc(C(F)(F)C(F)(F)F)cn1C#N |
| InChI | InChI=1S/C7HF5N4/c8-6(9,7(10,11)12)4-2-16(3-14)5(1-13)15-4/h2H |
| InChIKey | TVCACDFAZSGRAN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|