C24H22F2N6OS — CID 135285432
(1S,5S,6S)-3-amino-5-[2-fluoro-5-[(Z)-2-fluoro-2-pyrido[3,4-b]pyrazin-7-ylethenyl]phenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide (PubChem CID 135285432) has the molecular formula C24H22F2N6OS and a molecular weight of 480.54 g/mol. Its IUPAC name is (1S,5S,6S)-3-amino-5-[2-fluoro-5-[(Z)-2-fluoro-2-pyrido[3,4-b]pyrazin-7-ylethenyl]phenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide.
| Compound Name | (1S,5S,6S)-3-amino-5-[2-fluoro-5-[(Z)-2-fluoro-2-pyrido[3,4-b]pyrazin-7-ylethenyl]phenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 135285432 |
| Molecular Formula | C24H22F2N6OS |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (1S,5S,6S)-3-amino-5-[2-fluoro-5-[(Z)-2-fluoro-2-pyrido[3,4-b]pyrazin-7-ylethenyl]phenyl]-N,N,5-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
| SMILES | CN(C)C(=O)[C@]12C[C@H]1[C@@](C)(c1cc(/C=C(\F)c3cc4nccnc4cn3)ccc1F)N=C(N)S2 |
| InChI | InChI=1S/C24H22F2N6OS/c1-23(20-11-24(20,21(33)32(2)3)34-22(27)31-23)14-8-13(4-5-15(14)25)9-16(26)17-10-18-19(12-30-17)29-7-6-28-18/h4-10,12,20H,11H2,1-3H3,(H2,27,31)/b16-9-/t20-,23+,24-/m0/s1 |
| InChIKey | KMBSVVYIQKJTAT-UELTYCCSSA-N |
| XLogP | 3.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |