C24H20F2N6 — CID 135287921
(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(1H-pyrazol-5-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 135287921) has the molecular formula C24H20F2N6 and a molecular weight of 430.46 g/mol. Its IUPAC name is (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(1H-pyrazol-5-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(1H-pyrazol-5-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 135287921 |
| Molecular Formula | C24H20F2N6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(1H-pyrazol-5-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@@]1(c1cncc(-c3ccn[nH]3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H20F2N6/c1-23(2)14-6-8-24(23,20-12-27-11-19(29-20)17-7-9-28-30-17)22-13(14)10-18(31-32-22)21-15(25)4-3-5-16(21)26/h3-5,7,9-12,14H,6,8H2,1-2H3,(H,28,30)/t14-,24+/m0/s1 |
| InChIKey | JQDXTBPBKXJGGW-LFPIHBKWSA-N |
| XLogP | 4.81 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |