About (Z)-octadec-9-enoate;octylazanium
(Z)-octadec-9-enoate;octylazanium (PubChem CID 135289707) has the molecular formula C26H53NO2
and a molecular weight of 411.72 g/mol. Its IUPAC name is (Z)-octadec-9-enoate;octylazanium.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoate;octylazanium |
| PubChem CID | 135289707 |
| Molecular Formula | C26H53NO2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.41 |
| IUPAC Name | (Z)-octadec-9-enoate;octylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC[NH3+] |
| InChI | InChI=1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-9H2,1H3/b10-9-; |
| InChIKey | MRNFQHLUCFSZPP-KVVVOXFISA-N |
| XLogP | 6.36 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoate;octylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoate;octylazanium?
The IUPAC name of (Z)-octadec-9-enoate;octylazanium (CID 135289707) is (Z)-octadec-9-enoate;octylazanium.
What is the SMILES notation for (Z)-octadec-9-enoate;octylazanium?
The canonical SMILES for (Z)-octadec-9-enoate;octylazanium is CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC[NH3+].
What is the InChIKey of (Z)-octadec-9-enoate;octylazanium?
The InChIKey is MRNFQHLUCFSZPP-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-9H2,1H3/b10-9-;.
What are the key properties of (Z)-octadec-9-enoate;octylazanium?
(Z)-octadec-9-enoate;octylazanium has a molecular weight of 411.72 g/mol, XLogP of 6.36, 21 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoate;octylazanium is sourced from PubChem (CID 135289707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).