About 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid
2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 135290239) has the molecular formula C24H22N2O6
and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid |
| PubChem CID | 135290239 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)c(OCc2cccnc2)c1OC |
| InChI | InChI=1S/C24H22N2O6/c1-30-20-11-9-17(22(23(20)31-2)32-15-16-6-5-13-25-14-16)10-12-21(27)26-19-8-4-3-7-18(19)24(28)29/h3-14H,15H2,1-2H3,(H,26,27)(H,28,29)/b12-10+ |
| InChIKey | OSNRPVWWLRPZDA-ZRDIBKRKSA-N |
| XLogP | 4.03 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid?
The IUPAC name of 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid (CID 135290239) is 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid.
What is the SMILES notation for 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid?
The canonical SMILES for 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid is COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)c(OCc2cccnc2)c1OC.
What is the InChIKey of 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid?
The InChIKey is OSNRPVWWLRPZDA-ZRDIBKRKSA-N. The full InChI is InChI=1S/C24H22N2O6/c1-30-20-11-9-17(22(23(20)31-2)32-15-16-6-5-13-25-14-16)10-12-21(27)26-19-8-4-3-7-18(19)24(28)29/h3-14H,15H2,1-2H3,(H,26,27)(H,28,29)/b12-10+.
What are the key properties of 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid?
2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid has a molecular weight of 434.45 g/mol, XLogP of 4.03, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-3-[3,4-dimethoxy-2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoic acid is sourced from PubChem (CID 135290239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).