C24H17ClFN5S — CID 135290544
(9S)-7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 135290544) has the molecular formula C24H17ClFN5S and a molecular weight of 461.95 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 135290544 |
| Molecular Formula | C24H17ClFN5S |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1c(C#Cc2ccc(F)cn2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H17ClFN5S/c1-13-20(11-10-19-9-8-18(26)12-27-19)32-24-21(13)22(16-4-6-17(25)7-5-16)28-14(2)23-30-29-15(3)31(23)24/h4-9,12,14H,1-3H3/t14-/m0/s1 |
| InChIKey | HSQZZCFKBBPHAE-AWEZNQCLSA-N |
| XLogP | 5.44 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|