C26H25ClN6S — CID 135290553
(9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-(2-methylpropyl)-4-[2-(1-methylpyrazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 135290553) has the molecular formula C26H25ClN6S and a molecular weight of 489.05 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-(2-methylpropyl)-4-[2-(1-methylpyrazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-(2-methylpropyl)-4-[2-(1-methylpyrazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 135290553 |
| Molecular Formula | C26H25ClN6S |
| Molecular Weight | 489.05 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-(2-methylpropyl)-4-[2-(1-methylpyrazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1c(C#Cc2cnn(C)c2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](CC(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C26H25ClN6S/c1-15(2)12-21-25-31-30-17(4)33(25)26-23(24(29-21)19-7-9-20(27)10-8-19)16(3)22(34-26)11-6-18-13-28-32(5)14-18/h7-10,13-15,21H,12H2,1-5H3/t21-/m0/s1 |
| InChIKey | XWDOQTYLELRCKG-NRFANRHFSA-N |
| XLogP | 5.67 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|