C28H27ClN8OS — CID 135290571
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-piperazin-1-ylethanone (PubChem CID 135290571) has the molecular formula C28H27ClN8OS and a molecular weight of 559.10 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-piperazin-1-ylethanone.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 135290571 |
| Molecular Formula | C28H27ClN8OS |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-piperazin-1-ylethanone |
| SMILES | Cc1c(C#Cc2cncn2C)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N1CCNCC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C28H27ClN8OS/c1-17-23(9-8-21-15-31-16-35(21)3)39-28-25(17)26(19-4-6-20(29)7-5-19)32-22(27-34-33-18(2)37(27)28)14-24(38)36-12-10-30-11-13-36/h4-7,15-16,22,30H,10-14H2,1-3H3/t22-/m0/s1 |
| InChIKey | WSRNRBJRCKWSIN-QFIPXVFZSA-N |
| XLogP | 3.45 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|