C23H19ClN6S — CID 135290579
(9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-4-[2-(2-methylpyrazol-3-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 135290579) has the molecular formula C23H19ClN6S and a molecular weight of 446.97 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-4-[2-(2-methylpyrazol-3-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-4-[2-(2-methylpyrazol-3-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 135290579 |
| Molecular Formula | C23H19ClN6S |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-4-[2-(2-methylpyrazol-3-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1c(C#Cc2ccnn2C)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C23H19ClN6S/c1-13-19(10-9-18-11-12-25-29(18)4)31-23-20(13)21(16-5-7-17(24)8-6-16)26-14(2)22-28-27-15(3)30(22)23/h5-8,11-12,14H,1-4H3/t14-/m0/s1 |
| InChIKey | QGEPYIAZTMLCSK-AWEZNQCLSA-N |
| XLogP | 4.64 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|