C27H20ClN7S2 — CID 135290603
(9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 135290603) has the molecular formula C27H20ClN7S2 and a molecular weight of 542.09 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 135290603 |
| Molecular Formula | C27H20ClN7S2 |
| Molecular Weight | 542.09 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc(C[C@@H]2N=C(c3ccc(Cl)cc3)c3c(sc(C#Cc4ccccn4)c3C)-n3c(C)nnc32)s1 |
| InChI | InChI=1S/C27H20ClN7S2/c1-15-22(12-11-20-6-4-5-13-29-20)37-27-24(15)25(18-7-9-19(28)10-8-18)30-21(14-23-33-32-17(3)36-23)26-34-31-16(2)35(26)27/h4-10,13,21H,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | CHPXNJAOCXWQFL-NRFANRHFSA-N |
| XLogP | 5.69 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|