C30H26ClFN6OS — CID 135290642
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(4-fluoropiperidin-1-yl)ethanone (PubChem CID 135290642) has the molecular formula C30H26ClFN6OS and a molecular weight of 573.10 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(4-fluoropiperidin-1-yl)ethanone.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(4-fluoropiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 135290642 |
| Molecular Formula | C30H26ClFN6OS |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(4-fluoropiperidin-1-yl)ethanone |
| SMILES | Cc1c(C#Cc2ccccn2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N1CCC(F)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C30H26ClFN6OS/c1-18-25(11-10-23-5-3-4-14-33-23)40-30-27(18)28(20-6-8-21(31)9-7-20)34-24(29-36-35-19(2)38(29)30)17-26(39)37-15-12-22(32)13-16-37/h3-9,14,22,24H,12-13,15-17H2,1-2H3/t24-/m0/s1 |
| InChIKey | MKWYNLPXBHYECD-DEOSSOPVSA-N |
| XLogP | 5.64 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|