C26H30N2O4 — CID 135291112
diethyl 3,5-dimethyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1-phenylpyrazine-2,6-dicarboxylate (PubChem CID 135291112) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is diethyl 3,5-dimethyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1-phenylpyrazine-2,6-dicarboxylate.
| Compound Name | diethyl 3,5-dimethyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1-phenylpyrazine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 135291112 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | diethyl 3,5-dimethyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1-phenylpyrazine-2,6-dicarboxylate |
| SMILES | C=C/C=C\C=C(/C=C)N1C(C)=C(C(=O)OCC)N(c2ccccc2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C26H30N2O4/c1-7-11-13-16-21(8-2)27-19(5)23(25(29)31-9-3)28(22-17-14-12-15-18-22)24(20(27)6)26(30)32-10-4/h7-8,11-18H,1-2,9-10H2,3-6H3/b13-11-,21-16+ |
| InChIKey | DNQCCQYTEKCSLY-WOXKRFSJSA-N |
| XLogP | 5.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|