About 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane
6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane (PubChem CID 135291325) has the molecular formula C14H29FO
and a molecular weight of 232.38 g/mol. Its IUPAC name is 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane.
Molecular Properties
| Compound Name | 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane |
| PubChem CID | 135291325 |
| Molecular Formula | C14H29FO |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane |
| SMILES | CC(C)(C)CCOCCCC(C)(C)CCF |
| InChI | InChI=1S/C14H29FO/c1-13(2,3)9-12-16-11-6-7-14(4,5)8-10-15/h6-12H2,1-5H3 |
| InChIKey | GWRVPHZUIMQMLN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane?
The IUPAC name of 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane (CID 135291325) is 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane.
What is the SMILES notation for 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane?
The canonical SMILES for 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane is CC(C)(C)CCOCCCC(C)(C)CCF.
What is the InChIKey of 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane?
The InChIKey is GWRVPHZUIMQMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29FO/c1-13(2,3)9-12-16-11-6-7-14(4,5)8-10-15/h6-12H2,1-5H3.
What are the key properties of 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane?
6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane has a molecular weight of 232.38 g/mol, XLogP of 4.61, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-dimethylbutoxy)-1-fluoro-3,3-dimethylhexane is sourced from PubChem (CID 135291325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).