C11H15ClF3N — CID 135291341
N-[(3E,5E)-4-chloro-7,7,7-trifluoro-2,2,6-trimethylhepta-3,5-dien-3-yl]methanimine (PubChem CID 135291341) has the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. Its IUPAC name is N-[(3E,5E)-4-chloro-7,7,7-trifluoro-2,2,6-trimethylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E,5E)-4-chloro-7,7,7-trifluoro-2,2,6-trimethylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 135291341 |
| Molecular Formula | C11H15ClF3N |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[(3E,5E)-4-chloro-7,7,7-trifluoro-2,2,6-trimethylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C(Cl)\C=C(/C)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H15ClF3N/c1-7(11(13,14)15)6-8(12)9(16-5)10(2,3)4/h6H,5H2,1-4H3/b7-6+,9-8+ |
| InChIKey | HUCNXMVHHPPQRA-BLHCBFLLSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|