C12H18F3N — CID 135291361
N-[(2E)-3-tert-butyl-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine (PubChem CID 135291361) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is N-[(2E)-3-tert-butyl-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E)-3-tert-butyl-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 135291361 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[(2E)-3-tert-butyl-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(=C(\C=C(C)C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N/c1-8(2)7-9(11(3,4)5)10(16-6)12(13,14)15/h7H,6H2,1-5H3/b10-9+ |
| InChIKey | VLHKEEAHNLZYAS-MDZDMXLPSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|