About (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one
(4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 135291697) has the molecular formula C11H17FN2O4
and a molecular weight of 260.26 g/mol. Its IUPAC name is (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one |
| PubChem CID | 135291697 |
| Molecular Formula | C11H17FN2O4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CCO[C@H]1CCN(C(=O)[C@@H]2COC(=O)N2)C[C@H]1F |
| InChI | InChI=1S/C11H17FN2O4/c1-2-17-9-3-4-14(5-7(9)12)10(15)8-6-18-11(16)13-8/h7-9H,2-6H2,1H3,(H,13,16)/t7-,8+,9+/m1/s1 |
| InChIKey | JLSYVZFSAXAICH-VGMNWLOBSA-N |
| XLogP | 0.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one (CID 135291697) is (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one is CCO[C@H]1CCN(C(=O)[C@@H]2COC(=O)N2)C[C@H]1F.
What is the InChIKey of (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one?
The InChIKey is JLSYVZFSAXAICH-VGMNWLOBSA-N. The full InChI is InChI=1S/C11H17FN2O4/c1-2-17-9-3-4-14(5-7(9)12)10(15)8-6-18-11(16)13-8/h7-9H,2-6H2,1H3,(H,13,16)/t7-,8+,9+/m1/s1.
What are the key properties of (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one?
(4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one has a molecular weight of 260.26 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(3R,4S)-4-ethoxy-3-fluoropiperidine-1-carbonyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 135291697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).