About 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline
4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline (PubChem CID 135291836) has the molecular formula C19H15Cl8NS3
and a molecular weight of 637.16 g/mol. Its IUPAC name is 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline.
Molecular Properties
| Compound Name | 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline |
| PubChem CID | 135291836 |
| Molecular Formula | C19H15Cl8NS3 |
| Molecular Weight | 637.16 g/mol |
| Exact Mass | 632.79 |
| IUPAC Name | 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline |
| SMILES | CS(Cl)(Cl)c1ccc(N(c2ccc(S(Cl)(Cl)Cl)cc2)c2ccc(S(Cl)(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15Cl8NS3/c1-29(20,21)17-8-2-14(3-9-17)28(15-4-10-18(11-5-15)30(22,23)24)16-6-12-19(13-7-16)31(25,26)27/h2-13H,1H3 |
| InChIKey | FQUXCMYCCPVZME-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.16 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline?
The IUPAC name of 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline (CID 135291836) is 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline.
What is the SMILES notation for 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline?
The canonical SMILES for 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline is CS(Cl)(Cl)c1ccc(N(c2ccc(S(Cl)(Cl)Cl)cc2)c2ccc(S(Cl)(Cl)Cl)cc2)cc1.
What is the InChIKey of 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline?
The InChIKey is FQUXCMYCCPVZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl8NS3/c1-29(20,21)17-8-2-14(3-9-17)28(15-4-10-18(11-5-15)30(22,23)24)16-6-12-19(13-7-16)31(25,26)27/h2-13H,1H3.
What are the key properties of 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline?
4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline has a molecular weight of 637.16 g/mol, XLogP of 12.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[dichloro(methyl)-λ4-sulfanyl]-N,N-bis[4-(trichloro-λ4-sulfanyl)phenyl]aniline is sourced from PubChem (CID 135291836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).