About (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine
(2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine (PubChem CID 135292598) has the molecular formula C10H12F3N
and a molecular weight of 203.21 g/mol. Its IUPAC name is (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine.
Molecular Properties
| Compound Name | (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine |
| PubChem CID | 135292598 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine |
| SMILES | C/C1=C/N=C(C(F)(F)F)\C=C/CCC1 |
| InChI | InChI=1S/C10H12F3N/c1-8-5-3-2-4-6-9(14-7-8)10(11,12)13/h4,6-7H,2-3,5H2,1H3/b6-4-,8-7-,14-9+ |
| InChIKey | JTJPCUWAVUOIPD-AGHMALIZSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine?
The IUPAC name of (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine (CID 135292598) is (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine.
What is the SMILES notation for (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine?
The canonical SMILES for (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine is C/C1=C/N=C(C(F)(F)F)\C=C/CCC1.
What is the InChIKey of (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine?
The InChIKey is JTJPCUWAVUOIPD-AGHMALIZSA-N. The full InChI is InChI=1S/C10H12F3N/c1-8-5-3-2-4-6-9(14-7-8)10(11,12)13/h4,6-7H,2-3,5H2,1H3/b6-4-,8-7-,14-9+.
What are the key properties of (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine?
(2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine has a molecular weight of 203.21 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,7Z)-3-methyl-9-(trifluoromethyl)-5,6-dihydro-4H-azonine is sourced from PubChem (CID 135292598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).