About (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine
(2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine (PubChem CID 135292628) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine.
Molecular Properties
| Compound Name | (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine |
| PubChem CID | 135292628 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine |
| SMILES | CC1=c2nc(C)c(CN)cc2=CCC1 |
| InChI | InChI=1S/C12H16N2/c1-8-4-3-5-10-6-11(7-13)9(2)14-12(8)10/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | QRNADDZLYZICEM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine?
The IUPAC name of (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine (CID 135292628) is (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine.
What is the SMILES notation for (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine?
The canonical SMILES for (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine is CC1=c2nc(C)c(CN)cc2=CCC1.
What is the InChIKey of (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine?
The InChIKey is QRNADDZLYZICEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-8-4-3-5-10-6-11(7-13)9(2)14-12(8)10/h5-6H,3-4,7,13H2,1-2H3.
What are the key properties of (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine?
(2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine has a molecular weight of 188.27 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,8-dimethyl-6,7-dihydroquinolin-3-yl)methanamine is sourced from PubChem (CID 135292628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).