C26H31N3O9 — CID 135292752
3,3,4,4-tetrahydroxy-N-methyl-2-[7-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide (PubChem CID 135292752) has the molecular formula C26H31N3O9 and a molecular weight of 529.55 g/mol. Its IUPAC name is 3,3,4,4-tetrahydroxy-N-methyl-2-[7-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide.
| Compound Name | 3,3,4,4-tetrahydroxy-N-methyl-2-[7-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 135292752 |
| Molecular Formula | C26H31N3O9 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 3,3,4,4-tetrahydroxy-N-methyl-2-[7-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
| SMILES | CNC(=O)C(N1Cc2c(OCc3ccc(CN4CCOCC4)cc3)cccc2C1=O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C26H31N3O9/c1-27-23(31)22(26(35,36)25(33,34)16-30)29-14-20-19(24(29)32)3-2-4-21(20)38-15-18-7-5-17(6-8-18)13-28-9-11-37-12-10-28/h2-8,16,22,33-36H,9-15H2,1H3,(H,27,31) |
| InChIKey | GHMYWTYSEHXXGA-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|