About 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane
3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane (PubChem CID 135292772) has the molecular formula C14H16FN
and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane.
Molecular Properties
| Compound Name | 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane |
| PubChem CID | 135292772 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane |
| SMILES | CCN1CC2(c3ccc(F)c(C)c3)C3C1C32 |
| InChI | InChI=1S/C14H16FN/c1-3-16-7-14(11-12(14)13(11)16)9-4-5-10(15)8(2)6-9/h4-6,11-13H,3,7H2,1-2H3 |
| InChIKey | DERJSRFIXRGSIM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane?
The IUPAC name of 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane (CID 135292772) is 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane.
What is the SMILES notation for 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane?
The canonical SMILES for 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane is CCN1CC2(c3ccc(F)c(C)c3)C3C1C32.
What is the InChIKey of 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane?
The InChIKey is DERJSRFIXRGSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN/c1-3-16-7-14(11-12(14)13(11)16)9-4-5-10(15)8(2)6-9/h4-6,11-13H,3,7H2,1-2H3.
What are the key properties of 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane?
3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane has a molecular weight of 217.29 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(4-fluoro-3-methylphenyl)-3-azatricyclo[3.1.0.02,6]hexane is sourced from PubChem (CID 135292772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).