About (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane
(5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 135292775) has the molecular formula C15H19Cl2N
and a molecular weight of 284.23 g/mol. Its IUPAC name is (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 135292775 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | CC(C)N1C[C@@H]2CC2(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19Cl2N/c1-10(2)18-8-12-7-15(12,9-18)6-11-3-4-13(16)14(17)5-11/h3-5,10,12H,6-9H2,1-2H3/t12-,15?/m0/s1 |
| InChIKey | RYOHJCISZJQSMG-SFVWDYPZSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane (CID 135292775) is (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane is CC(C)N1C[C@@H]2CC2(Cc2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The InChIKey is RYOHJCISZJQSMG-SFVWDYPZSA-N. The full InChI is InChI=1S/C15H19Cl2N/c1-10(2)18-8-12-7-15(12,9-18)6-11-3-4-13(16)14(17)5-11/h3-5,10,12H,6-9H2,1-2H3/t12-,15?/m0/s1.
What are the key properties of (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
(5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane has a molecular weight of 284.23 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-[(3,4-dichlorophenyl)methyl]-3-propan-2-yl-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 135292775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).