C28H58N3O4P — CID 135293023
N-[2-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-3-(2,2,4,4-tetramethylpentanoylamino)propyl]-2,2,4,4-tetramethylpentanamide (PubChem CID 135293023) has the molecular formula C28H58N3O4P and a molecular weight of 531.76 g/mol. Its IUPAC name is N-[2-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-3-(2,2,4,4-tetramethylpentanoylamino)propyl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[2-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-3-(2,2,4,4-tetramethylpentanoylamino)propyl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 135293023 |
| Molecular Formula | C28H58N3O4P |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.42 |
| IUPAC Name | N-[2-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-3-(2,2,4,4-tetramethylpentanoylamino)propyl]-2,2,4,4-tetramethylpentanamide |
| SMILES | COP(OC(CNC(=O)C(C)(C)CC(C)(C)C)CNC(=O)C(C)(C)CC(C)(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H58N3O4P/c1-20(2)31(21(3)4)36(34-15)35-22(16-29-23(32)27(11,12)18-25(5,6)7)17-30-24(33)28(13,14)19-26(8,9)10/h20-22H,16-19H2,1-15H3,(H,29,32)(H,30,33) |
| InChIKey | IZAQLBRYNUWPGP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|