About 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine
1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine (PubChem CID 135293078) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine |
| PubChem CID | 135293078 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine |
| SMILES | CC1=CCC(N2CCCCC2)C=C1 |
| InChI | InChI=1S/C12H19N/c1-11-5-7-12(8-6-11)13-9-3-2-4-10-13/h5-7,12H,2-4,8-10H2,1H3 |
| InChIKey | NBWWZLWQCUCCNY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine?
The IUPAC name of 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine (CID 135293078) is 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine.
What is the SMILES notation for 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine?
The canonical SMILES for 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine is CC1=CCC(N2CCCCC2)C=C1.
What is the InChIKey of 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine?
The InChIKey is NBWWZLWQCUCCNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-11-5-7-12(8-6-11)13-9-3-2-4-10-13/h5-7,12H,2-4,8-10H2,1H3.
What are the key properties of 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine?
1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine has a molecular weight of 177.29 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylcyclohexa-2,4-dien-1-yl)piperidine is sourced from PubChem (CID 135293078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).