About (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium
(3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium (PubChem CID 135293649) has the molecular formula C16H34NS+
and a molecular weight of 272.52 g/mol. Its IUPAC name is (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium.
Molecular Properties
| Compound Name | (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium |
| PubChem CID | 135293649 |
| Molecular Formula | C16H34NS+ |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium |
| SMILES | C=C(C[N+](C)(C)CCCS)C(C)(CC)CC(C)C |
| InChI | InChI=1S/C16H33NS/c1-8-16(5,12-14(2)3)15(4)13-17(6,7)10-9-11-18/h14H,4,8-13H2,1-3,5-7H3/p+1 |
| InChIKey | WDOBZMNVZGJGSP-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium?
The IUPAC name of (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium (CID 135293649) is (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium.
What is the SMILES notation for (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium?
The canonical SMILES for (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium is C=C(C[N+](C)(C)CCCS)C(C)(CC)CC(C)C.
What is the InChIKey of (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium?
The InChIKey is WDOBZMNVZGJGSP-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H33NS/c1-8-16(5,12-14(2)3)15(4)13-17(6,7)10-9-11-18/h14H,4,8-13H2,1-3,5-7H3/p+1.
What are the key properties of (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium?
(3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium has a molecular weight of 272.52 g/mol, XLogP of 4.40, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-3,5-dimethyl-2-methylidenehexyl)-dimethyl-(3-sulfanylpropyl)azanium is sourced from PubChem (CID 135293649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).