C9H14N2O — CID 135293917
(3E,5E)-N,N-dimethyl-7-nitrosohepta-1,3,5-trien-3-amine (PubChem CID 135293917) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (3E,5E)-N,N-dimethyl-7-nitrosohepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N,N-dimethyl-7-nitrosohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 135293917 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (3E,5E)-N,N-dimethyl-7-nitrosohepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C\CN=O)N(C)C |
| InChI | InChI=1S/C9H14N2O/c1-4-9(11(2)3)7-5-6-8-10-12/h4-7H,1,8H2,2-3H3/b6-5+,9-7+ |
| InChIKey | GBLRXEAKGOVQQY-SBIWHPGTSA-N |
| XLogP | 1.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|