C26H35N7O2 — CID 135293922
6-amino-1-[8-[[(2R)-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one (PubChem CID 135293922) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 6-amino-1-[8-[[(2R)-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one.
| Compound Name | 6-amino-1-[8-[[(2R)-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 135293922 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 6-amino-1-[8-[[(2R)-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
| SMILES | Cn1cnc2c(N3CCC[C@@H]3COc3cccc4c3CN(C(=O)CCCCCN)CC4)ncnc21 |
| InChI | InChI=1S/C26H35N7O2/c1-31-18-30-24-25(31)28-17-29-26(24)33-13-6-8-20(33)16-35-22-9-5-7-19-11-14-32(15-21(19)22)23(34)10-3-2-4-12-27/h5,7,9,17-18,20H,2-4,6,8,10-16,27H2,1H3/t20-/m1/s1 |
| InChIKey | HSJUQKGWMIVOFF-HXUWFJFHSA-N |
| XLogP | 2.81 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|