C32H46N2O5P+ — CID 135294175
2-[[6,20-bis(2-methoxyethyl)-2,2-dimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-ethoxyphosphoryl]ethanol (PubChem CID 135294175) has the molecular formula C32H46N2O5P+ and a molecular weight of 569.70 g/mol. Its IUPAC name is 2-[[6,20-bis(2-methoxyethyl)-2,2-dimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-ethoxyphosphoryl]ethanol.
| Compound Name | 2-[[6,20-bis(2-methoxyethyl)-2,2-dimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-ethoxyphosphoryl]ethanol |
|---|---|
| PubChem CID | 135294175 |
| Molecular Formula | C32H46N2O5P+ |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | 2-[[6,20-bis(2-methoxyethyl)-2,2-dimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-ethoxyphosphoryl]ethanol |
| SMILES | CCOP(=O)(CCO)C1=c2cc3c(cc2C(C)(C)c2cc4c(cc21)CCCN4CCOC)=[N+](CCOC)CCC3 |
| InChI | InChI=1S/C32H46N2O5P/c1-6-39-40(36,18-15-35)31-25-19-23-9-7-11-33(13-16-37-4)29(23)21-27(25)32(2,3)28-22-30-24(20-26(28)31)10-8-12-34(30)14-17-38-5/h19-22,35H,6-18H2,1-5H3/q+1 |
| InChIKey | JYAANQSXNSNDIY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|