About 3-(ethenylamino)-N,N'-dimethylpropanimidamide
3-(ethenylamino)-N,N'-dimethylpropanimidamide (PubChem CID 135294306) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 3-(ethenylamino)-N,N'-dimethylpropanimidamide.
Molecular Properties
| Compound Name | 3-(ethenylamino)-N,N'-dimethylpropanimidamide |
| PubChem CID | 135294306 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 3-(ethenylamino)-N,N'-dimethylpropanimidamide |
| SMILES | C=CNCC/C(=N/C)NC |
| InChI | InChI=1S/C7H15N3/c1-4-10-6-5-7(8-2)9-3/h4,10H,1,5-6H2,2-3H3,(H,8,9) |
| InChIKey | VRLNNXCZCFKLHO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethenylamino)-N,N'-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethenylamino)-N,N'-dimethylpropanimidamide?
The IUPAC name of 3-(ethenylamino)-N,N'-dimethylpropanimidamide (CID 135294306) is 3-(ethenylamino)-N,N'-dimethylpropanimidamide.
What is the SMILES notation for 3-(ethenylamino)-N,N'-dimethylpropanimidamide?
The canonical SMILES for 3-(ethenylamino)-N,N'-dimethylpropanimidamide is C=CNCC/C(=N/C)NC.
What is the InChIKey of 3-(ethenylamino)-N,N'-dimethylpropanimidamide?
The InChIKey is VRLNNXCZCFKLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-10-6-5-7(8-2)9-3/h4,10H,1,5-6H2,2-3H3,(H,8,9).
What are the key properties of 3-(ethenylamino)-N,N'-dimethylpropanimidamide?
3-(ethenylamino)-N,N'-dimethylpropanimidamide has a molecular weight of 141.22 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethenylamino)-N,N'-dimethylpropanimidamide is sourced from PubChem (CID 135294306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).