C15H30N2OS — CID 135294468
(R)-2-methyl-N-[(4R)-3-methyl-8-azaspiro[4.5]decan-4-yl]butane-2-sulfinamide (PubChem CID 135294468) has the molecular formula C15H30N2OS and a molecular weight of 286.48 g/mol. Its IUPAC name is (R)-2-methyl-N-[(4R)-3-methyl-8-azaspiro[4.5]decan-4-yl]butane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(4R)-3-methyl-8-azaspiro[4.5]decan-4-yl]butane-2-sulfinamide |
|---|---|
| PubChem CID | 135294468 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (R)-2-methyl-N-[(4R)-3-methyl-8-azaspiro[4.5]decan-4-yl]butane-2-sulfinamide |
| SMILES | CCC(C)(C)[S@@](=O)N[C@@H]1C(C)CCC12CCNCC2 |
| InChI | InChI=1S/C15H30N2OS/c1-5-14(3,4)19(18)17-13-12(2)6-7-15(13)8-10-16-11-9-15/h12-13,16-17H,5-11H2,1-4H3/t12?,13-,19-/m1/s1 |
| InChIKey | GARJFGZXFHOLCU-OEXLVKHLSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |