About (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine
(3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine (PubChem CID 135294525) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine |
| PubChem CID | 135294525 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine |
| SMILES | C=C/C(=C/CCNC/C=C(/C)OC)OC |
| InChI | InChI=1S/C12H21NO2/c1-5-12(15-4)7-6-9-13-10-8-11(2)14-3/h5,7-8,13H,1,6,9-10H2,2-4H3/b11-8-,12-7- |
| InChIKey | SPQPMMBIMWZQBD-HONFXZPPSA-N |
| XLogP | 2.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine?
The IUPAC name of (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine (CID 135294525) is (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine.
What is the SMILES notation for (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine?
The canonical SMILES for (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine is C=C/C(=C/CCNC/C=C(/C)OC)OC.
What is the InChIKey of (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine?
The InChIKey is SPQPMMBIMWZQBD-HONFXZPPSA-N. The full InChI is InChI=1S/C12H21NO2/c1-5-12(15-4)7-6-9-13-10-8-11(2)14-3/h5,7-8,13H,1,6,9-10H2,2-4H3/b11-8-,12-7-.
What are the key properties of (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine?
(3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine has a molecular weight of 211.30 g/mol, XLogP of 2.23, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-methoxy-N-[(Z)-3-methoxybut-2-enyl]hexa-3,5-dien-1-amine is sourced from PubChem (CID 135294525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).