C21H34N2 — CID 135294784
(4E)-4-[[3,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrol-5-yl]methylidene]-3-propan-2-ylidenehex-5-en-2-imine (PubChem CID 135294784) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is (4E)-4-[[3,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrol-5-yl]methylidene]-3-propan-2-ylidenehex-5-en-2-imine.
| Compound Name | (4E)-4-[[3,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrol-5-yl]methylidene]-3-propan-2-ylidenehex-5-en-2-imine |
|---|---|
| PubChem CID | 135294784 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (4E)-4-[[3,4-dimethyl-1-(3-methylbutyl)-2,3-dihydropyrrol-5-yl]methylidene]-3-propan-2-ylidenehex-5-en-2-imine |
| SMILES | [H]/N=C(\C)C(=C(C)C)/C(C=C)=C/C1=C(C)C(C)CN1CCC(C)C |
| InChI | InChI=1S/C21H34N2/c1-9-19(21(15(4)5)18(8)22)12-20-17(7)16(6)13-23(20)11-10-14(2)3/h9,12,14,16,22H,1,10-11,13H2,2-8H3/b19-12+,22-18+ |
| InChIKey | SIITVZCOFIWOOV-NTYCFPRQSA-N |
| XLogP | 5.75 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|