About 4-(1-methoxybutyl)thiane
4-(1-methoxybutyl)thiane (PubChem CID 135295100) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is 4-(1-methoxybutyl)thiane.
Molecular Properties
| Compound Name | 4-(1-methoxybutyl)thiane |
| PubChem CID | 135295100 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-(1-methoxybutyl)thiane |
| SMILES | CCCC(OC)C1CCSCC1 |
| InChI | InChI=1S/C10H20OS/c1-3-4-10(11-2)9-5-7-12-8-6-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | ODIILWKQIRKRTL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-methoxybutyl)thiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methoxybutyl)thiane?
The IUPAC name of 4-(1-methoxybutyl)thiane (CID 135295100) is 4-(1-methoxybutyl)thiane.
What is the SMILES notation for 4-(1-methoxybutyl)thiane?
The canonical SMILES for 4-(1-methoxybutyl)thiane is CCCC(OC)C1CCSCC1.
What is the InChIKey of 4-(1-methoxybutyl)thiane?
The InChIKey is ODIILWKQIRKRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OS/c1-3-4-10(11-2)9-5-7-12-8-6-9/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(1-methoxybutyl)thiane?
4-(1-methoxybutyl)thiane has a molecular weight of 188.34 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methoxybutyl)thiane is sourced from PubChem (CID 135295100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).