C22H27N7S — CID 135295283
6-[(E)-3-(2-methylidenehydrazinyl)but-2-en-2-yl]-N-[4-(4-methylpiperazin-1-yl)-2-pyridinyl]-1,3-benzothiazol-2-amine (PubChem CID 135295283) has the molecular formula C22H27N7S and a molecular weight of 421.57 g/mol. Its IUPAC name is 6-[(E)-3-(2-methylidenehydrazinyl)but-2-en-2-yl]-N-[4-(4-methylpiperazin-1-yl)-2-pyridinyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(E)-3-(2-methylidenehydrazinyl)but-2-en-2-yl]-N-[4-(4-methylpiperazin-1-yl)-2-pyridinyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 135295283 |
| Molecular Formula | C22H27N7S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-[(E)-3-(2-methylidenehydrazinyl)but-2-en-2-yl]-N-[4-(4-methylpiperazin-1-yl)-2-pyridinyl]-1,3-benzothiazol-2-amine |
| SMILES | C=NN/C(C)=C(\C)c1ccc2nc(Nc3cc(N4CCN(C)CC4)ccn3)sc2c1 |
| InChI | InChI=1S/C22H27N7S/c1-15(16(2)27-23-3)17-5-6-19-20(13-17)30-22(25-19)26-21-14-18(7-8-24-21)29-11-9-28(4)10-12-29/h5-8,13-14,27H,3,9-12H2,1-2,4H3,(H,24,25,26)/b16-15+ |
| InChIKey | JSTDTXASIBLLNU-FOCLMDBBSA-N |
| XLogP | 4.14 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|