About (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine
(4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine (PubChem CID 135295384) has the molecular formula C12H26N2S
and a molecular weight of 230.42 g/mol. Its IUPAC name is (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine.
Molecular Properties
| Compound Name | (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine |
| PubChem CID | 135295384 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine |
| SMILES | CCN1CC[C@H](NC)[C@](C)(CSC)CC1 |
| InChI | InChI=1S/C12H26N2S/c1-5-14-8-6-11(13-3)12(2,7-9-14)10-15-4/h11,13H,5-10H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | NUYQEYOROMZRDO-RYUDHWBXSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine?
The IUPAC name of (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine (CID 135295384) is (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine.
What is the SMILES notation for (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine?
The canonical SMILES for (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine is CCN1CC[C@H](NC)[C@](C)(CSC)CC1.
What is the InChIKey of (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine?
The InChIKey is NUYQEYOROMZRDO-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H26N2S/c1-5-14-8-6-11(13-3)12(2,7-9-14)10-15-4/h11,13H,5-10H2,1-4H3/t11-,12-/m0/s1.
What are the key properties of (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine?
(4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine has a molecular weight of 230.42 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-1-ethyl-N,5-dimethyl-5-(methylsulfanylmethyl)azepan-4-amine is sourced from PubChem (CID 135295384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).