About N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine
N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine (PubChem CID 135295414) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine |
| PubChem CID | 135295414 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine |
| SMILES | C=NC1CC(CC)C=C(C)C=C1CC |
| InChI | InChI=1S/C13H21N/c1-5-11-7-10(3)8-12(6-2)13(9-11)14-4/h7-8,11,13H,4-6,9H2,1-3H3 |
| InChIKey | YWJKRPHZOCYXLY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine?
The IUPAC name of N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine (CID 135295414) is N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine.
What is the SMILES notation for N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine?
The canonical SMILES for N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine is C=NC1CC(CC)C=C(C)C=C1CC.
What is the InChIKey of N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine?
The InChIKey is YWJKRPHZOCYXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-5-11-7-10(3)8-12(6-2)13(9-11)14-4/h7-8,11,13H,4-6,9H2,1-3H3.
What are the key properties of N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine?
N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine has a molecular weight of 191.32 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-diethyl-4-methylcyclohepta-2,4-dien-1-yl)methanimine is sourced from PubChem (CID 135295414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).